C16H17F4N7O — CID 118650793
2-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,4-dihydro-1,3,5-triazin-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 118650793) has the molecular formula C16H17F4N7O and a molecular weight of 399.35 g/mol. Its IUPAC name is 2-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,4-dihydro-1,3,5-triazin-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,4-dihydro-1,3,5-triazin-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 118650793 |
| Molecular Formula | C16H17F4N7O |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-[[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,4-dihydro-1,3,5-triazin-4-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C)(NC1N=CNC(c2c[nH]c3ncc(F)cc23)=N1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C16H17F4N7O/c1-15(2,13(28)23-6-16(18,19)20)27-14-25-7-24-12(26-14)10-5-22-11-9(10)3-8(17)4-21-11/h3-5,7,14,27H,6H2,1-2H3,(H,21,22)(H,23,28)(H,24,25,26) |
| InChIKey | SWXVOWOPKGFIKE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |