C19H14N2O4 — CID 118721367
4-(3-nitrophenyl)-6-phenyl-4,5-dihydro-3aH-2,1-benzoxazol-3-one (PubChem CID 118721367) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-6-phenyl-4,5-dihydro-3aH-2,1-benzoxazol-3-one.
| Compound Name | 4-(3-nitrophenyl)-6-phenyl-4,5-dihydro-3aH-2,1-benzoxazol-3-one |
|---|---|
| PubChem CID | 118721367 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(3-nitrophenyl)-6-phenyl-4,5-dihydro-3aH-2,1-benzoxazol-3-one |
| SMILES | O=C1ON=C2C=C(c3ccccc3)CC(c3cccc([N+](=O)[O-])c3)C12 |
| InChI | InChI=1S/C19H14N2O4/c22-19-18-16(13-7-4-8-15(9-13)21(23)24)10-14(11-17(18)20-25-19)12-5-2-1-3-6-12/h1-9,11,16,18H,10H2 |
| InChIKey | PKPAPTZUVVHERQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|