C26H33NO2 — CID 118731427
(4aS,9aR)-2-(cyclopropylmethyl)-4a-(5-phenylpentyl)-1,3,4,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-6-ol (PubChem CID 118731427) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (4aS,9aR)-2-(cyclopropylmethyl)-4a-(5-phenylpentyl)-1,3,4,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-6-ol.
| Compound Name | (4aS,9aR)-2-(cyclopropylmethyl)-4a-(5-phenylpentyl)-1,3,4,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-6-ol |
|---|---|
| PubChem CID | 118731427 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (4aS,9aR)-2-(cyclopropylmethyl)-4a-(5-phenylpentyl)-1,3,4,9a-tetrahydro-[1]benzofuro[2,3-c]pyridin-6-ol |
| SMILES | Oc1ccc2c(c1)[C@]1(CCCCCc3ccccc3)CCN(CC3CC3)C[C@@H]1O2 |
| InChI | InChI=1S/C26H33NO2/c28-22-12-13-24-23(17-22)26(14-6-2-5-9-20-7-3-1-4-8-20)15-16-27(18-21-10-11-21)19-25(26)29-24/h1,3-4,7-8,12-13,17,21,25,28H,2,5-6,9-11,14-16,18-19H2/t25-,26-/m0/s1 |
| InChIKey | XQXRLEVMBWPGQK-UIOOFZCWSA-N |
| XLogP | 5.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|