C51H50F2N4 — CID 118857336
4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinoline (PubChem CID 118857336) has the molecular formula C51H50F2N4 and a molecular weight of 756.99 g/mol. Its IUPAC name is 4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinoline.
| Compound Name | 4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinoline |
|---|---|
| PubChem CID | 118857336 |
| Molecular Formula | C51H50F2N4 |
| Molecular Weight | 756.99 g/mol |
| Exact Mass | 756.40 |
| IUPAC Name | 4-[4-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]phenyl]-1-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)isoquinoline |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(-c4cnc(-c5ccc6c(c5)C(C)(C)C(F)(F)C6(C)C)c5ccccc45)cc3)nc(-c3ccc(C(C)(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C51H50F2N4/c1-47(2,3)36-24-19-33(20-25-36)45-55-44(56-46(57-45)34-21-26-37(27-22-34)48(4,5)6)32-17-15-31(16-18-32)40-30-54-43(39-14-12-11-13-38(39)40)35-23-28-41-42(29-35)50(9,10)51(52,53)49(41,7)8/h11-30H,1-10H3 |
| InChIKey | COPOYTYPWGVWHZ-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.99 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |