C20H22O2 — CID 118964821
5-(3,4-dimethyl-2-propoxyphenyl)-2,3-dihydroinden-1-one (PubChem CID 118964821) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5-(3,4-dimethyl-2-propoxyphenyl)-2,3-dihydroinden-1-one.
| Compound Name | 5-(3,4-dimethyl-2-propoxyphenyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 118964821 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 5-(3,4-dimethyl-2-propoxyphenyl)-2,3-dihydroinden-1-one |
| SMILES | CCCOc1c(-c2ccc3c(c2)CCC3=O)ccc(C)c1C |
| InChI | InChI=1S/C20H22O2/c1-4-11-22-20-14(3)13(2)5-8-18(20)16-6-9-17-15(12-16)7-10-19(17)21/h5-6,8-9,12H,4,7,10-11H2,1-3H3 |
| InChIKey | OQOSCXHGYQOTFL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |