carbon monoxide;tungsten;1,2-xylene

C11H10O3W — CID 11987132

IUPACcarbon monoxide;tungsten;1,2-xylene
SMILESCc1ccccc1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W]
InChIInChI=1S/C8H10.3CO.W/c1-7-5-3-4-6-8(7)2;3*1-2;/h3-6H,1-2H3;;;;
InChIKeyVCLSSLPVDXPNBF-UHFFFAOYSA-N
MW374.04 g/mol
LogP2.19
Rot. Bonds

About carbon monoxide;tungsten;1,2-xylene

carbon monoxide;tungsten;1,2-xylene (PubChem CID 11987132) has the molecular formula C11H10O3W and a molecular weight of 374.04 g/mol. Its IUPAC name is carbon monoxide;tungsten;1,2-xylene.

Molecular Properties

Compound Namecarbon monoxide;tungsten;1,2-xylene
PubChem CID11987132
Molecular FormulaC11H10O3W
Molecular Weight374.04 g/mol
Exact Mass374.01
IUPAC Namecarbon monoxide;tungsten;1,2-xylene
SMILESCc1ccccc1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W]
InChIInChI=1S/C8H10.3CO.W/c1-7-5-3-4-6-8(7)2;3*1-2;/h3-6H,1-2H3;;;;
InChIKeyVCLSSLPVDXPNBF-UHFFFAOYSA-N
XLogP2.19
TPSA59.70 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500374.04
LogP ≤ 52.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;tungsten;1,2-xylene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;tungsten;1,2-xylene?
The IUPAC name of carbon monoxide;tungsten;1,2-xylene (CID 11987132) is carbon monoxide;tungsten;1,2-xylene.
What is the SMILES notation for carbon monoxide;tungsten;1,2-xylene?
The canonical SMILES for carbon monoxide;tungsten;1,2-xylene is Cc1ccccc1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;tungsten;1,2-xylene?
The InChIKey is VCLSSLPVDXPNBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.3CO.W/c1-7-5-3-4-6-8(7)2;3*1-2;/h3-6H,1-2H3;;;;.
What are the key properties of carbon monoxide;tungsten;1,2-xylene?
carbon monoxide;tungsten;1,2-xylene has a molecular weight of 374.04 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;tungsten;1,2-xylene is sourced from PubChem (CID 11987132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).