About carbon monoxide;tungsten;1,2-xylene
carbon monoxide;tungsten;1,2-xylene (PubChem CID 11987132) has the molecular formula C11H10O3W
and a molecular weight of 374.04 g/mol. Its IUPAC name is carbon monoxide;tungsten;1,2-xylene.
Molecular Properties
| Compound Name | carbon monoxide;tungsten;1,2-xylene |
| PubChem CID | 11987132 |
| Molecular Formula | C11H10O3W |
| Molecular Weight | 374.04 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | carbon monoxide;tungsten;1,2-xylene |
| SMILES | Cc1ccccc1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W] |
| InChI | InChI=1S/C8H10.3CO.W/c1-7-5-3-4-6-8(7)2;3*1-2;/h3-6H,1-2H3;;;; |
| InChIKey | VCLSSLPVDXPNBF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.04 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;tungsten;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;tungsten;1,2-xylene?
The IUPAC name of carbon monoxide;tungsten;1,2-xylene (CID 11987132) is carbon monoxide;tungsten;1,2-xylene.
What is the SMILES notation for carbon monoxide;tungsten;1,2-xylene?
The canonical SMILES for carbon monoxide;tungsten;1,2-xylene is Cc1ccccc1C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[W].
What is the InChIKey of carbon monoxide;tungsten;1,2-xylene?
The InChIKey is VCLSSLPVDXPNBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.3CO.W/c1-7-5-3-4-6-8(7)2;3*1-2;/h3-6H,1-2H3;;;;.
What are the key properties of carbon monoxide;tungsten;1,2-xylene?
carbon monoxide;tungsten;1,2-xylene has a molecular weight of 374.04 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;tungsten;1,2-xylene is sourced from PubChem (CID 11987132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).