C9H12BrFO2 — CID 12010744
(1R,4S,5S,6S)-5-bromo-4-fluoro-4,7,7-trimethyl-3-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 12010744) has the molecular formula C9H12BrFO2 and a molecular weight of 251.09 g/mol. Its IUPAC name is (1R,4S,5S,6S)-5-bromo-4-fluoro-4,7,7-trimethyl-3-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,4S,5S,6S)-5-bromo-4-fluoro-4,7,7-trimethyl-3-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 12010744 |
| Molecular Formula | C9H12BrFO2 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | (1R,4S,5S,6S)-5-bromo-4-fluoro-4,7,7-trimethyl-3-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | CC1(C)[C@@H]2[C@H]1C(=O)O[C@@](C)(F)[C@H]2Br |
| InChI | InChI=1S/C9H12BrFO2/c1-8(2)4-5(8)7(12)13-9(3,11)6(4)10/h4-6H,1-3H3/t4-,5+,6+,9-/m1/s1 |
| InChIKey | PFGOZICRSSRASH-RXUAOQPESA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|