C12H11NO6S — CID 121012247
3-[(1,3-dioxoisoindol-2-yl)methylsulfonyl]propanoic acid (PubChem CID 121012247) has the molecular formula C12H11NO6S and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methylsulfonyl]propanoic acid.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 121012247 |
| Molecular Formula | C12H11NO6S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methylsulfonyl]propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H11NO6S/c14-10(15)5-6-20(18,19)7-13-11(16)8-3-1-2-4-9(8)12(13)17/h1-4H,5-7H2,(H,14,15) |
| InChIKey | DHXUOPXHBRCCHS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|