C15H30N+ — CID 121299463
2,3,4,5-tetramethyl-6-azoniaspiro[5.6]dodecane (PubChem CID 121299463) has the molecular formula C15H30N+ and a molecular weight of 224.41 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-6-azoniaspiro[5.6]dodecane.
| Compound Name | 2,3,4,5-tetramethyl-6-azoniaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 121299463 |
| Molecular Formula | C15H30N+ |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.24 |
| IUPAC Name | 2,3,4,5-tetramethyl-6-azoniaspiro[5.6]dodecane |
| SMILES | CC1C[N+]2(CCCCCC2)C(C)C(C)C1C |
| InChI | InChI=1S/C15H30N/c1-12-11-16(9-7-5-6-8-10-16)15(4)14(3)13(12)2/h12-15H,5-11H2,1-4H3/q+1 |
| InChIKey | UXCODTBPIWEOCL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|