C17H11NO6 — CID 122191718
(3R,4S)-4-(furan-2-yl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione (PubChem CID 122191718) has the molecular formula C17H11NO6 and a molecular weight of 325.28 g/mol. Its IUPAC name is (3R,4S)-4-(furan-2-yl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione.
| Compound Name | (3R,4S)-4-(furan-2-yl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 122191718 |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (3R,4S)-4-(furan-2-yl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)[C@H](c1ccco1)[C@@H]([N+](=O)[O-])CO2 |
| InChI | InChI=1S/C17H11NO6/c19-15-9-4-1-2-5-10(9)16(20)17-14(15)13(12-6-3-7-23-12)11(8-24-17)18(21)22/h1-7,11,13H,8H2/t11-,13-/m0/s1 |
| InChIKey | SAWIIIQAQQCCFO-AAEUAGOBSA-N |
| XLogP | 2.37 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|