C24H21NO2S — CID 122203533
1-(4-methylphenyl)sulfonyl-3,4-diphenyl-4H-pyridine (PubChem CID 122203533) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3,4-diphenyl-4H-pyridine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3,4-diphenyl-4H-pyridine |
|---|---|
| PubChem CID | 122203533 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3,4-diphenyl-4H-pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C=CC(c3ccccc3)C(c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C24H21NO2S/c1-19-12-14-22(15-13-19)28(26,27)25-17-16-23(20-8-4-2-5-9-20)24(18-25)21-10-6-3-7-11-21/h2-18,23H,1H3 |
| InChIKey | ZHBWWRRWOAHGIX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |