C16H20F2OSi2 — CID 122205893
[dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silyl]oxy-dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silane (PubChem CID 122205893) has the molecular formula C16H20F2OSi2 and a molecular weight of 328.54 g/mol. Its IUPAC name is [dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silyl]oxy-dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silane.
| Compound Name | [dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silyl]oxy-dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silane |
|---|---|
| PubChem CID | 122205893 |
| Molecular Formula | C16H20F2OSi2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silyl]oxy-dimethyl-(3,4,5-trideuterio-2-fluorophenyl)silane |
| SMILES | [2H]c1cc([Si](C)(C)O[Si](C)(C)c2cc([2H])c([2H])c([2H])c2F)c(F)c([2H])c1[2H] |
| InChI | InChI=1S/C16H20F2OSi2/c1-20(2,15-11-7-5-9-13(15)17)19-21(3,4)16-12-8-6-10-14(16)18/h5-12H,1-4H3/i5D,6D,7D,8D,9D,10D |
| InChIKey | OUWSQICGHUHOSM-VNBWLILLSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|