C45H54O9Si — CID 122382623
4-O-methyl 1-O-prop-2-enyl (2E)-2-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)phenyl]-2-[(4-methoxyphenyl)methoxy]propylidene]butanedioate (PubChem CID 122382623) has the molecular formula C45H54O9Si and a molecular weight of 767.00 g/mol. Its IUPAC name is 4-O-methyl 1-O-prop-2-enyl (2E)-2-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)phenyl]-2-[(4-methoxyphenyl)methoxy]propylidene]butanedioate.
| Compound Name | 4-O-methyl 1-O-prop-2-enyl (2E)-2-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)phenyl]-2-[(4-methoxyphenyl)methoxy]propylidene]butanedioate |
|---|---|
| PubChem CID | 122382623 |
| Molecular Formula | C45H54O9Si |
| Molecular Weight | 767.00 g/mol |
| Exact Mass | 766.35 |
| IUPAC Name | 4-O-methyl 1-O-prop-2-enyl (2E)-2-[(2R)-3-[2-[tert-butyl(dimethyl)silyl]oxy-4,6-bis(phenylmethoxy)phenyl]-2-[(4-methoxyphenyl)methoxy]propylidene]butanedioate |
| SMILES | C=CCOC(=O)/C(=C/[C@@H](Cc1c(OCc2ccccc2)cc(OCc2ccccc2)cc1O[Si](C)(C)C(C)(C)C)OCc1ccc(OC)cc1)CC(=O)OC |
| InChI | InChI=1S/C45H54O9Si/c1-9-24-50-44(47)36(26-43(46)49-6)25-38(51-31-35-20-22-37(48-5)23-21-35)27-40-41(53-32-34-18-14-11-15-19-34)28-39(52-30-33-16-12-10-13-17-33)29-42(40)54-55(7,8)45(2,3)4/h9-23,25,28-29,38H,1,24,26-27,30-32H2,2-8H3/b36-25+/t38-/m0/s1 |
| InChIKey | UXRPQUUCLXWKGU-AGWVKNLESA-N |
| XLogP | 9.58 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.00 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|