C14H12O4 — CID 122403734
(1S,5S)-1-(1,3-benzodioxole-5-carbonyl)bicyclo[3.1.0]hexan-2-one (PubChem CID 122403734) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is (1S,5S)-1-(1,3-benzodioxole-5-carbonyl)bicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5S)-1-(1,3-benzodioxole-5-carbonyl)bicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 122403734 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (1S,5S)-1-(1,3-benzodioxole-5-carbonyl)bicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1CC[C@H]2C[C@@]12C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12O4/c15-12-4-2-9-6-14(9,12)13(16)8-1-3-10-11(5-8)18-7-17-10/h1,3,5,9H,2,4,6-7H2/t9-,14-/m0/s1 |
| InChIKey | MBUMSIJWNBPCSY-XPTSAGLGSA-N |
| XLogP | 1.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|