About dimethylazanium;5-fluoropentane-1-sulfonate
dimethylazanium;5-fluoropentane-1-sulfonate (PubChem CID 122480961) has the molecular formula C7H18FNO3S
and a molecular weight of 215.29 g/mol. Its IUPAC name is dimethylazanium;5-fluoropentane-1-sulfonate.
Molecular Properties
| Compound Name | dimethylazanium;5-fluoropentane-1-sulfonate |
| PubChem CID | 122480961 |
| Molecular Formula | C7H18FNO3S |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | dimethylazanium;5-fluoropentane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCF |
| InChI | InChI=1S/C5H11FO3S.C2H7N/c6-4-2-1-3-5-10(7,8)9;1-3-2/h1-5H2,(H,7,8,9);3H,1-2H3 |
| InChIKey | RKNWYYZZZHRMDQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylazanium;5-fluoropentane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;5-fluoropentane-1-sulfonate?
The IUPAC name of dimethylazanium;5-fluoropentane-1-sulfonate (CID 122480961) is dimethylazanium;5-fluoropentane-1-sulfonate.
What is the SMILES notation for dimethylazanium;5-fluoropentane-1-sulfonate?
The canonical SMILES for dimethylazanium;5-fluoropentane-1-sulfonate is C[NH2+]C.O=S(=O)([O-])CCCCCF.
What is the InChIKey of dimethylazanium;5-fluoropentane-1-sulfonate?
The InChIKey is RKNWYYZZZHRMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11FO3S.C2H7N/c6-4-2-1-3-5-10(7,8)9;1-3-2/h1-5H2,(H,7,8,9);3H,1-2H3.
What are the key properties of dimethylazanium;5-fluoropentane-1-sulfonate?
dimethylazanium;5-fluoropentane-1-sulfonate has a molecular weight of 215.29 g/mol, XLogP of -0.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;5-fluoropentane-1-sulfonate is sourced from PubChem (CID 122480961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).