C18H33NO2 — CID 122495761
tert-butyl N-[(2E)-cyclooct-2-en-1-yl]-N-(2,2-dimethylpropyl)carbamate (PubChem CID 122495761) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is tert-butyl N-[(2E)-cyclooct-2-en-1-yl]-N-(2,2-dimethylpropyl)carbamate.
| Compound Name | tert-butyl N-[(2E)-cyclooct-2-en-1-yl]-N-(2,2-dimethylpropyl)carbamate |
|---|---|
| PubChem CID | 122495761 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | tert-butyl N-[(2E)-cyclooct-2-en-1-yl]-N-(2,2-dimethylpropyl)carbamate |
| SMILES | CC(C)(C)CN(C(=O)OC(C)(C)C)C1/C=C\CCCCC1 |
| InChI | InChI=1S/C18H33NO2/c1-17(2,3)14-19(16(20)21-18(4,5)6)15-12-10-8-7-9-11-13-15/h10,12,15H,7-9,11,13-14H2,1-6H3/b12-10- |
| InChIKey | ODQZBVKMRXHXGJ-BENRWUELSA-N |
| XLogP | 5.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|