C28H32F6N2O4S — CID 122511010
1-cyclopropylsulfonyl-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-3H-pyridin-6-one (PubChem CID 122511010) has the molecular formula C28H32F6N2O4S and a molecular weight of 606.63 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-3H-pyridin-6-one.
| Compound Name | 1-cyclopropylsulfonyl-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-3H-pyridin-6-one |
|---|---|
| PubChem CID | 122511010 |
| Molecular Formula | C28H32F6N2O4S |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | 1-cyclopropylsulfonyl-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-3H-pyridin-6-one |
| SMILES | CC(C)n1ccc(C2=CC(=O)N(S(=O)(=O)C3CC3)C(c3ccc(OCCCCCC(F)(F)F)cc3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C28H32F6N2O4S/c1-19(2)35-14-12-20(18-35)21-16-25(37)36(41(38,39)24-10-11-24)26(17-21,28(32,33)34)22-6-8-23(9-7-22)40-15-5-3-4-13-27(29,30)31/h6-9,12,14,16,18-19,24H,3-5,10-11,13,15,17H2,1-2H3 |
| InChIKey | XFNHVRNZPFXQGN-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|