C13H16ClF3N2O3 — CID 122543000
3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-1-methylurea (PubChem CID 122543000) has the molecular formula C13H16ClF3N2O3 and a molecular weight of 340.73 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-1-methylurea.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-1-methylurea |
|---|---|
| PubChem CID | 122543000 |
| Molecular Formula | C13H16ClF3N2O3 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,2-dimethoxyethyl)-1-methylurea |
| SMILES | COC(CN(C)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C13H16ClF3N2O3/c1-19(7-11(21-2)22-3)12(20)18-8-4-5-10(14)9(6-8)13(15,16)17/h4-6,11H,7H2,1-3H3,(H,18,20) |
| InChIKey | LPARZBFJWCEAGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|