C19H26NO5P — CID 122551617
methyl (2S)-2-[[cyclohexa-1,5-dien-1-yloxy(phenoxy)phosphoryl]amino]-4-methylpentanoate (PubChem CID 122551617) has the molecular formula C19H26NO5P and a molecular weight of 379.39 g/mol. Its IUPAC name is methyl (2S)-2-[[cyclohexa-1,5-dien-1-yloxy(phenoxy)phosphoryl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[cyclohexa-1,5-dien-1-yloxy(phenoxy)phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 122551617 |
| Molecular Formula | C19H26NO5P |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl (2S)-2-[[cyclohexa-1,5-dien-1-yloxy(phenoxy)phosphoryl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NP(=O)(OC1=CCCC=C1)Oc1ccccc1 |
| InChI | InChI=1S/C19H26NO5P/c1-15(2)14-18(19(21)23-3)20-26(22,24-16-10-6-4-7-11-16)25-17-12-8-5-9-13-17/h4,6-8,10-13,15,18H,5,9,14H2,1-3H3,(H,20,22)/t18-,26?/m0/s1 |
| InChIKey | YUDFIEMBYYHFNR-MDYZWHIJSA-N |
| XLogP | 4.60 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|