C9H4N4O2 — CID 122583508
1,3-diethynyl-7H-purine-2,6-dione (PubChem CID 122583508) has the molecular formula C9H4N4O2 and a molecular weight of 200.16 g/mol. Its IUPAC name is 1,3-diethynyl-7H-purine-2,6-dione.
| Compound Name | 1,3-diethynyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 122583508 |
| Molecular Formula | C9H4N4O2 |
| Molecular Weight | 200.16 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 1,3-diethynyl-7H-purine-2,6-dione |
| SMILES | C#Cn1c(=O)c2[nH]cnc2n(C#C)c1=O |
| InChI | InChI=1S/C9H4N4O2/c1-3-12-7-6(10-5-11-7)8(14)13(4-2)9(12)15/h1-2,5H,(H,10,11) |
| InChIKey | IJYUYRNYJKLULC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.16 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|