C17H23NO5 — CID 122592676
2-(2-cyanoethenyl)hept-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 122592676) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-(2-cyanoethenyl)hept-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-cyanoethenyl)hept-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122592676 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-(2-cyanoethenyl)hept-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.CCCCC=C(C=CC#N)C(=O)O |
| InChI | InChI=1S/C10H13NO2.C7H10O3/c1-2-3-4-6-9(10(12)13)7-5-8-11;1-5(2)7(8)10-4-6-3-9-6/h5-7H,2-4H2,1H3,(H,12,13);6H,1,3-4H2,2H3 |
| InChIKey | MQOJDAJESGAHAA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|