C18H35N5O5 — CID 122609745
methyl (2S)-6-[3-(3-methyldiaziridin-3-yl)propylcarbamoylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 122609745) has the molecular formula C18H35N5O5 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl (2S)-6-[3-(3-methyldiaziridin-3-yl)propylcarbamoylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-[3-(3-methyldiaziridin-3-yl)propylcarbamoylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 122609745 |
| Molecular Formula | C18H35N5O5 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | methyl (2S)-6-[3-(3-methyldiaziridin-3-yl)propylcarbamoylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)NCCCC1(C)NN1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35N5O5/c1-17(2,3)28-16(26)21-13(14(24)27-5)9-6-7-11-19-15(25)20-12-8-10-18(4)22-23-18/h13,22-23H,6-12H2,1-5H3,(H,21,26)(H2,19,20,25)/t13-/m0/s1 |
| InChIKey | QBUGASONZZTLFP-ZDUSSCGKSA-N |
| XLogP | 1.13 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|