C10H10O6-2 — CID 122706196
(E,2E)-2-[carboxy(oxido)methylidene]-6-methyl-5-oxohept-3-enoate (PubChem CID 122706196) has the molecular formula C10H10O6-2 and a molecular weight of 226.18 g/mol. Its IUPAC name is (E,2E)-2-[carboxy(oxido)methylidene]-6-methyl-5-oxohept-3-enoate.
| Compound Name | (E,2E)-2-[carboxy(oxido)methylidene]-6-methyl-5-oxohept-3-enoate |
|---|---|
| PubChem CID | 122706196 |
| Molecular Formula | C10H10O6-2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (E,2E)-2-[carboxy(oxido)methylidene]-6-methyl-5-oxohept-3-enoate |
| SMILES | CC(C)C(=O)/C=C/C(C(=O)[O-])=C(\[O-])C(=O)O |
| InChI | InChI=1S/C10H12O6/c1-5(2)7(11)4-3-6(9(13)14)8(12)10(15)16/h3-5,12H,1-2H3,(H,13,14)(H,15,16)/p-2/b4-3+,8-6+ |
| InChIKey | QIADQBIXDULDTJ-PBOULFJWSA-L |
| XLogP | -1.78 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|