C30H47BrO3 — CID 123159623
[(3E)-4-ethenyl-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexyl] 2-bromoacetate (PubChem CID 123159623) has the molecular formula C30H47BrO3 and a molecular weight of 535.61 g/mol. Its IUPAC name is [(3E)-4-ethenyl-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexyl] 2-bromoacetate.
| Compound Name | [(3E)-4-ethenyl-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexyl] 2-bromoacetate |
|---|---|
| PubChem CID | 123159623 |
| Molecular Formula | C30H47BrO3 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | [(3E)-4-ethenyl-3-[2-[1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexyl] 2-bromoacetate |
| SMILES | C=CC1CCC(OC(=O)CBr)C/C1=C\C=C1CCCC2(C)C1CCC2C(C)CCCC(C)(C)O |
| InChI | InChI=1S/C30H47BrO3/c1-6-22-13-14-25(34-28(32)20-31)19-24(22)12-11-23-10-8-18-30(5)26(15-16-27(23)30)21(2)9-7-17-29(3,4)33/h6,11-12,21-22,25-27,33H,1,7-10,13-20H2,2-5H3/b23-11?,24-12+ |
| InChIKey | CILMGXYRDBQJNI-GMURABKZSA-N |
| XLogP | 7.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|