C15H28O6P2 — CID 123234249
(3,7,11-trimethyl-1-phosphonododeca-1,6,10-trienyl)phosphonic acid (PubChem CID 123234249) has the molecular formula C15H28O6P2 and a molecular weight of 366.33 g/mol. Its IUPAC name is (3,7,11-trimethyl-1-phosphonododeca-1,6,10-trienyl)phosphonic acid.
| Compound Name | (3,7,11-trimethyl-1-phosphonododeca-1,6,10-trienyl)phosphonic acid |
|---|---|
| PubChem CID | 123234249 |
| Molecular Formula | C15H28O6P2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (3,7,11-trimethyl-1-phosphonododeca-1,6,10-trienyl)phosphonic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)C=C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C15H28O6P2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(22(16,17)18)23(19,20)21/h7,9,11,14H,5-6,8,10H2,1-4H3,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | RSTNOYORXYMVPQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|