C16H26O3 — CID 123252680
11,11-dimethyl-3,5,7-trioxatetracyclo[7.7.1.02,4.06,8]heptadecane (PubChem CID 123252680) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 11,11-dimethyl-3,5,7-trioxatetracyclo[7.7.1.02,4.06,8]heptadecane.
| Compound Name | 11,11-dimethyl-3,5,7-trioxatetracyclo[7.7.1.02,4.06,8]heptadecane |
|---|---|
| PubChem CID | 123252680 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 11,11-dimethyl-3,5,7-trioxatetracyclo[7.7.1.02,4.06,8]heptadecane |
| SMILES | CC1(C)CCCCCC2CC(C1)C1OC1OC1OC21 |
| InChI | InChI=1S/C16H26O3/c1-16(2)7-5-3-4-6-10-8-11(9-16)13-15(18-13)19-14-12(10)17-14/h10-15H,3-9H2,1-2H3 |
| InChIKey | YBIDVDRCVNSIQV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|