C5H16N4 — CID 123254215
1-[amino(ethyl)amino]propane-1,2-diamine (PubChem CID 123254215) has the molecular formula C5H16N4 and a molecular weight of 132.21 g/mol. Its IUPAC name is 1-[amino(ethyl)amino]propane-1,2-diamine.
| Compound Name | 1-[amino(ethyl)amino]propane-1,2-diamine |
|---|---|
| PubChem CID | 123254215 |
| Molecular Formula | C5H16N4 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | 1-[amino(ethyl)amino]propane-1,2-diamine |
| SMILES | CCN(N)C(N)C(C)N |
| InChI | InChI=1S/C5H16N4/c1-3-9(8)5(7)4(2)6/h4-5H,3,6-8H2,1-2H3 |
| InChIKey | WPLMBHLSCPLUCR-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|