C20H13ClF5N5O3 — CID 123276323
5-(4-chlorophenyl)-2-[[3-(2,3-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one (PubChem CID 123276323) has the molecular formula C20H13ClF5N5O3 and a molecular weight of 501.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[3-(2,3-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[3-(2,3-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 123276323 |
| Molecular Formula | C20H13ClF5N5O3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[3-(2,3-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(-c3cccc(F)c3F)no2)nc(-c2ccc(Cl)cc2)n1CC(O)C(F)(F)F |
| InChI | InChI=1S/C20H13ClF5N5O3/c21-11-6-4-10(5-7-11)18-28-31(19(33)30(18)8-14(32)20(24,25)26)9-15-27-17(29-34-15)12-2-1-3-13(22)16(12)23/h1-7,14,32H,8-9H2 |
| InChIKey | IUTFJZWGISGNPJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |