C20H39N — CID 123276533
3-ethyl-8,9-dimethyl-3,6-dipropyldec-8-en-2-imine (PubChem CID 123276533) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is 3-ethyl-8,9-dimethyl-3,6-dipropyldec-8-en-2-imine.
| Compound Name | 3-ethyl-8,9-dimethyl-3,6-dipropyldec-8-en-2-imine |
|---|---|
| PubChem CID | 123276533 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | 3-ethyl-8,9-dimethyl-3,6-dipropyldec-8-en-2-imine |
| SMILES | [H]/N=C(\C)C(CC)(CCC)CCC(CCC)CC(C)=C(C)C |
| InChI | InChI=1S/C20H39N/c1-8-11-19(15-17(6)16(4)5)12-14-20(10-3,13-9-2)18(7)21/h19,21H,8-15H2,1-7H3/b21-18+ |
| InChIKey | BZIPDPZRXSHESY-DYTRJAOYSA-N |
| XLogP | 7.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|