C7H12N4O2 — CID 123276977
3-methyl-1,2,5,7,8,9-hexahydro-1,2,4,5-tetrazecine-6,10-dione (PubChem CID 123276977) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-methyl-1,2,5,7,8,9-hexahydro-1,2,4,5-tetrazecine-6,10-dione.
| Compound Name | 3-methyl-1,2,5,7,8,9-hexahydro-1,2,4,5-tetrazecine-6,10-dione |
|---|---|
| PubChem CID | 123276977 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-methyl-1,2,5,7,8,9-hexahydro-1,2,4,5-tetrazecine-6,10-dione |
| SMILES | CC1=NNC(=O)CCCC(=O)NN1 |
| InChI | InChI=1S/C7H12N4O2/c1-5-8-10-6(12)3-2-4-7(13)11-9-5/h2-4H2,1H3,(H,8,9)(H,10,12)(H,11,13) |
| InChIKey | HJHOQBVJTWTERJ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |