C32H44N4O4 — CID 123318213
methyl 3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methylpyrazine-2-carbonyl)amino]propanoate (PubChem CID 123318213) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is methyl 3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methylpyrazine-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methylpyrazine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 123318213 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | methyl 3-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methylpyrazine-2-carbonyl)amino]propanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCC(NC(=O)c1cnc(C)cn1)C(=O)OC |
| InChI | InChI=1S/C32H44N4O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-30(37)35-26-29(32(39)40-3)36-31(38)28-25-33-27(2)24-34-28/h5-6,8-9,11-12,14-15,17-18,20-21,24-25,29H,4,7,10,13,16,19,22-23,26H2,1-3H3,(H,35,37)(H,36,38) |
| InChIKey | NRHGFWIFSMRTEA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|