C38H56N4O7 — CID 67110692
[3-hydroxy-2-(hydroxymethyl)propyl] 2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-4-[(5-methyl-4-oxidopyrazin-4-ium-2-carbonyl)amino]butanoate (PubChem CID 67110692) has the molecular formula C38H56N4O7 and a molecular weight of 680.89 g/mol. Its IUPAC name is [3-hydroxy-2-(hydroxymethyl)propyl] 2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-4-[(5-methyl-4-oxidopyrazin-4-ium-2-carbonyl)amino]butanoate.
| Compound Name | [3-hydroxy-2-(hydroxymethyl)propyl] 2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-4-[(5-methyl-4-oxidopyrazin-4-ium-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 67110692 |
| Molecular Formula | C38H56N4O7 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | [3-hydroxy-2-(hydroxymethyl)propyl] 2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethyl]-4-[(5-methyl-4-oxidopyrazin-4-ium-2-carbonyl)amino]butanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCC(CCNC(=O)c1c[n+]([O-])c(C)cn1)C(=O)OCC(CO)CO |
| InChI | InChI=1S/C38H56N4O7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-36(45)39-25-23-34(38(47)49-31-33(29-43)30-44)24-26-40-37(46)35-28-42(48)32(2)27-41-35/h4-5,7-8,10-11,13-14,16-17,19-20,27-28,33-34,43-44H,3,6,9,12,15,18,21-26,29-31H2,1-2H3,(H,39,45)(H,40,46) |
| InChIKey | WCWFTZPYPPYIIC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|