C12H21N — CID 123335649
(5Z,7E)-3,8-dimethyldeca-5,7-dien-4-imine (PubChem CID 123335649) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (5Z,7E)-3,8-dimethyldeca-5,7-dien-4-imine.
| Compound Name | (5Z,7E)-3,8-dimethyldeca-5,7-dien-4-imine |
|---|---|
| PubChem CID | 123335649 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (5Z,7E)-3,8-dimethyldeca-5,7-dien-4-imine |
| SMILES | [H]/N=C(/C=C\C=C(/C)CC)C(C)CC |
| InChI | InChI=1S/C12H21N/c1-5-10(3)8-7-9-12(13)11(4)6-2/h7-9,11,13H,5-6H2,1-4H3/b9-7-,10-8+,13-12- |
| InChIKey | CZPJYKPMCFJZSW-WRSDQDOQSA-N |
| XLogP | 3.96 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|