C22H32FN4O8P — CID 123347221
4-amino-1-[5-[[[(5,5-dimethyl-2-oxooxolan-3-yl)amino]-hexa-2,4-dien-3-yloxyphosphoryl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidin-2-one (PubChem CID 123347221) has the molecular formula C22H32FN4O8P and a molecular weight of 530.49 g/mol. Its IUPAC name is 4-amino-1-[5-[[[(5,5-dimethyl-2-oxooxolan-3-yl)amino]-hexa-2,4-dien-3-yloxyphosphoryl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[5-[[[(5,5-dimethyl-2-oxooxolan-3-yl)amino]-hexa-2,4-dien-3-yloxyphosphoryl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 123347221 |
| Molecular Formula | C22H32FN4O8P |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 4-amino-1-[5-[[[(5,5-dimethyl-2-oxooxolan-3-yl)amino]-hexa-2,4-dien-3-yloxyphosphoryl]oxymethyl]-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CC=CC(=CC)OP(=O)(NC1CC(C)(C)OC1=O)OCC1OC(n2ccc(N)nc2=O)C(C)(F)C1O |
| InChI | InChI=1S/C22H32FN4O8P/c1-6-8-13(7-2)35-36(31,26-14-11-21(3,4)34-18(14)29)32-12-15-17(28)22(5,23)19(33-15)27-10-9-16(24)25-20(27)30/h6-10,14-15,17,19,28H,11-12H2,1-5H3,(H,26,31)(H2,24,25,30) |
| InChIKey | SZZQNIPYTOIEAV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|