C36H47N4O2S2+ — CID 123351520
2-[[(2E,4E)-3-ethyl-5-[4-[2-[2-[4-[2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]prop-1-enyl]anilino]ethyldisulfanyl]ethylamino]phenyl]-4-methylpenta-2,4-dienylidene]amino]ethanol (PubChem CID 123351520) has the molecular formula C36H47N4O2S2+ and a molecular weight of 631.93 g/mol. Its IUPAC name is 2-[[(2E,4E)-3-ethyl-5-[4-[2-[2-[4-[2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]prop-1-enyl]anilino]ethyldisulfanyl]ethylamino]phenyl]-4-methylpenta-2,4-dienylidene]amino]ethanol.
| Compound Name | 2-[[(2E,4E)-3-ethyl-5-[4-[2-[2-[4-[2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]prop-1-enyl]anilino]ethyldisulfanyl]ethylamino]phenyl]-4-methylpenta-2,4-dienylidene]amino]ethanol |
|---|---|
| PubChem CID | 123351520 |
| Molecular Formula | C36H47N4O2S2+ |
| Molecular Weight | 631.93 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | 2-[[(2E,4E)-3-ethyl-5-[4-[2-[2-[4-[2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]prop-1-enyl]anilino]ethyldisulfanyl]ethylamino]phenyl]-4-methylpenta-2,4-dienylidene]amino]ethanol |
| SMILES | CCC(=C\C=N\CCO)/C(C)=C/c1ccc(NCCSSCCNc2ccc(C=C(C)c3cc[n+](CCO)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H46N4O2S2/c1-4-33(13-16-37-17-23-41)29(2)27-31-5-9-35(10-6-31)38-18-25-43-44-26-19-39-36-11-7-32(8-12-36)28-30(3)34-14-20-40(21-15-34)22-24-42/h5-16,20-21,27-28,41-42H,4,17-19,22-26H2,1-3H3,(H,37,38)/p+1 |
| InChIKey | GFHZOICMPDGART-UHFFFAOYSA-O |
| XLogP | 7.24 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.93 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|