C13H27NO2Si — CID 123368312
[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-azabicyclo[3.1.0]hexan-5-yl]methanol (PubChem CID 123368312) has the molecular formula C13H27NO2Si and a molecular weight of 257.45 g/mol. Its IUPAC name is [3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-azabicyclo[3.1.0]hexan-5-yl]methanol.
| Compound Name | [3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-azabicyclo[3.1.0]hexan-5-yl]methanol |
|---|---|
| PubChem CID | 123368312 |
| Molecular Formula | C13H27NO2Si |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-azabicyclo[3.1.0]hexan-5-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC2(CO)CC2N1 |
| InChI | InChI=1S/C13H27NO2Si/c1-12(2,3)17(4,5)16-8-10-6-13(9-15)7-11(13)14-10/h10-11,14-15H,6-9H2,1-5H3 |
| InChIKey | WCUNMQHSZLWJTM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|