C12H18N2O — CID 123470145
1-(3-ethenylhexa-3,5-dien-2-yl)piperazin-2-one (PubChem CID 123470145) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(3-ethenylhexa-3,5-dien-2-yl)piperazin-2-one.
| Compound Name | 1-(3-ethenylhexa-3,5-dien-2-yl)piperazin-2-one |
|---|---|
| PubChem CID | 123470145 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(3-ethenylhexa-3,5-dien-2-yl)piperazin-2-one |
| SMILES | C=CC=C(C=C)C(C)N1CCNCC1=O |
| InChI | InChI=1S/C12H18N2O/c1-4-6-11(5-2)10(3)14-8-7-13-9-12(14)15/h4-6,10,13H,1-2,7-9H2,3H3 |
| InChIKey | XPANRQKBSSWKKZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|