C62H63N2O4+ — CID 123476435
2-[[3-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]ethenyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethyl-1-octylindol-1-ium-5-carboxylic acid (PubChem CID 123476435) has the molecular formula C62H63N2O4+ and a molecular weight of 900.20 g/mol. Its IUPAC name is 2-[[3-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]ethenyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethyl-1-octylindol-1-ium-5-carboxylic acid.
| Compound Name | 2-[[3-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]ethenyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethyl-1-octylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 123476435 |
| Molecular Formula | C62H63N2O4+ |
| Molecular Weight | 900.20 g/mol |
| Exact Mass | 899.48 |
| IUPAC Name | 2-[[3-[2-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]ethenyl]-2-hydroxy-4-oxocyclobutylidene]methyl]-3,3-dimethyl-1-octylindol-1-ium-5-carboxylic acid |
| SMILES | CCCCCCCC[N+]1=C(C=C2C(=O)C(C=Cc3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3)C2O)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C62H62N2O4/c1-8-9-10-11-12-17-34-63-55-33-25-40(59(67)68)35-54(55)62(6,7)56(63)38-49-57(65)48(58(49)66)30-24-39-22-26-41(27-23-39)64(42-28-31-46-44-18-13-15-20-50(44)60(2,3)52(46)36-42)43-29-32-47-45-19-14-16-21-51(45)61(4,5)53(47)37-43/h13-16,18-33,35-38,48,57,65H,8-12,17,34H2,1-7H3/p+1 |
| InChIKey | NLTBVEXVSQDZPL-UHFFFAOYSA-O |
| XLogP | 14.40 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.20 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|