C24H34O — CID 123498381
4-[[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]methoxy]cyclohepta-1,2,4,6-tetraene (PubChem CID 123498381) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]methoxy]cyclohepta-1,2,4,6-tetraene.
| Compound Name | 4-[[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]methoxy]cyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 123498381 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 4-[[4-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]methoxy]cyclohepta-1,2,4,6-tetraene |
| SMILES | CC(C)(C)CC(C1C=CC(COC2=CC=CC=C=C2)=CC1)C(C)(C)C |
| InChI | InChI=1S/C24H34O/c1-23(2,3)17-22(24(4,5)6)20-15-13-19(14-16-20)18-25-21-11-9-7-8-10-12-21/h7-9,11-15,20,22H,16-18H2,1-6H3 |
| InChIKey | KEMLWZJGWKEEHG-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |