About (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate
(2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate (PubChem CID 123519688) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate.
Molecular Properties
| Compound Name | (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate |
| PubChem CID | 123519688 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate |
| SMILES | CCC#CCC1CC1OC(=O)NC(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-5-6-7-8-10-9-11(10)20-14(19)17-12(13(16)18)15(2,3)4/h10-12H,5,8-9H2,1-4H3,(H2,16,18)(H,17,19) |
| InChIKey | GXJXCAOSHZLCTH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate?
The IUPAC name of (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate (CID 123519688) is (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate.
What is the SMILES notation for (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate?
The canonical SMILES for (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate is CCC#CCC1CC1OC(=O)NC(C(N)=O)C(C)(C)C.
What is the InChIKey of (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate?
The InChIKey is GXJXCAOSHZLCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-5-6-7-8-10-9-11(10)20-14(19)17-12(13(16)18)15(2,3)4/h10-12H,5,8-9H2,1-4H3,(H2,16,18)(H,17,19).
What are the key properties of (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate?
(2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate has a molecular weight of 280.37 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate is sourced from PubChem (CID 123519688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).