C15H24N2O3 — CID 123519688
(2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate (PubChem CID 123519688) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate.
| Compound Name | (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 123519688 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2-pent-2-ynylcyclopropyl) N-(1-amino-3,3-dimethyl-1-oxobutan-2-yl)carbamate |
| SMILES | CCC#CCC1CC1OC(=O)NC(C(N)=O)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-5-6-7-8-10-9-11(10)20-14(19)17-12(13(16)18)15(2,3)4/h10-12H,5,8-9H2,1-4H3,(H2,16,18)(H,17,19) |
| InChIKey | GXJXCAOSHZLCTH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|