C22H22ClN9O — CID 123546601
4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-2-[3-(3-hydroxyazetidin-1-yl)propyl]benzonitrile (PubChem CID 123546601) has the molecular formula C22H22ClN9O and a molecular weight of 463.93 g/mol. Its IUPAC name is 4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-2-[3-(3-hydroxyazetidin-1-yl)propyl]benzonitrile.
| Compound Name | 4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-2-[3-(3-hydroxyazetidin-1-yl)propyl]benzonitrile |
|---|---|
| PubChem CID | 123546601 |
| Molecular Formula | C22H22ClN9O |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-chloro-5-[[4-(cyclopropylamino)-7-isocyanoimidazo[2,1-f][1,2,4]triazin-2-yl]amino]-2-[3-(3-hydroxyazetidin-1-yl)propyl]benzonitrile |
| SMILES | [C-]#[N+]c1cnc2c(NC3CC3)nc(Nc3cc(C#N)c(CCCN4CC(O)C4)cc3Cl)nn12 |
| InChI | InChI=1S/C22H22ClN9O/c1-25-19-10-26-21-20(27-15-4-5-15)29-22(30-32(19)21)28-18-8-14(9-24)13(7-17(18)23)3-2-6-31-11-16(33)12-31/h7-8,10,15-16,33H,2-6,11-12H2,(H2,27,28,29,30) |
| InChIKey | XGYFQDDRPKRELE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|