C40H50O19S3 — CID 123584234
2-O-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl] 1-O,3-O-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl] prop-1-ene-1,2,3-tricarboxylate (PubChem CID 123584234) has the molecular formula C40H50O19S3 and a molecular weight of 931.02 g/mol. Its IUPAC name is 2-O-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl] 1-O,3-O-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl] prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | 2-O-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl] 1-O,3-O-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl] prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 123584234 |
| Molecular Formula | C40H50O19S3 |
| Molecular Weight | 931.02 g/mol |
| Exact Mass | 930.21 |
| IUPAC Name | 2-O-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxymethyl] 1-O,3-O-bis[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethyl] prop-1-ene-1,2,3-tricarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCOC(=O)C(=CC(=O)OCCOCCOS(=O)(=O)c2ccc(C)cc2)CC(=O)OCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H50O19S3/c1-31-4-10-35(11-5-31)60(44,45)57-25-20-50-16-17-53-30-56-40(43)34(28-38(41)54-23-18-51-21-26-58-61(46,47)36-12-6-32(2)7-13-36)29-39(42)55-24-19-52-22-27-59-62(48,49)37-14-8-33(3)9-15-37/h4-15,28H,16-27,29-30H2,1-3H3 |
| InChIKey | HYFKDYCBCLQCSQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 245.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.02 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|