C27H38N3O9PS — CID 123610239
propan-2-yl 2-[[[2-[1-(2,4-dioxopyrimidin-1-yl)but-3-ynoxy]-3,4-dihydroxybutoxy]-phenoxyphosphinothioyl]amino]-4-methylpentanoate (PubChem CID 123610239) has the molecular formula C27H38N3O9PS and a molecular weight of 611.65 g/mol. Its IUPAC name is propan-2-yl 2-[[[2-[1-(2,4-dioxopyrimidin-1-yl)but-3-ynoxy]-3,4-dihydroxybutoxy]-phenoxyphosphinothioyl]amino]-4-methylpentanoate.
| Compound Name | propan-2-yl 2-[[[2-[1-(2,4-dioxopyrimidin-1-yl)but-3-ynoxy]-3,4-dihydroxybutoxy]-phenoxyphosphinothioyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 123610239 |
| Molecular Formula | C27H38N3O9PS |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | propan-2-yl 2-[[[2-[1-(2,4-dioxopyrimidin-1-yl)but-3-ynoxy]-3,4-dihydroxybutoxy]-phenoxyphosphinothioyl]amino]-4-methylpentanoate |
| SMILES | C#CCC(OC(COP(=S)(NC(CC(C)C)C(=O)OC(C)C)Oc1ccccc1)C(O)CO)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C27H38N3O9PS/c1-6-10-25(30-14-13-24(33)28-27(30)35)38-23(22(32)16-31)17-36-40(41,39-20-11-8-7-9-12-20)29-21(15-18(2)3)26(34)37-19(4)5/h1,7-9,11-14,18-19,21-23,25,31-32H,10,15-17H2,2-5H3,(H,29,41)(H,28,33,35) |
| InChIKey | OTSPBKMLHCAYHK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|