C16H26N2O5S — CID 123611562
(7-cyano-2,2-dioxo-5-pentyl-8-propan-2-yl-3-oxa-2λ6-thia-1-azabicyclo[5.1.0]octan-6-yl) acetate (PubChem CID 123611562) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is (7-cyano-2,2-dioxo-5-pentyl-8-propan-2-yl-3-oxa-2λ6-thia-1-azabicyclo[5.1.0]octan-6-yl) acetate.
| Compound Name | (7-cyano-2,2-dioxo-5-pentyl-8-propan-2-yl-3-oxa-2λ6-thia-1-azabicyclo[5.1.0]octan-6-yl) acetate |
|---|---|
| PubChem CID | 123611562 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (7-cyano-2,2-dioxo-5-pentyl-8-propan-2-yl-3-oxa-2λ6-thia-1-azabicyclo[5.1.0]octan-6-yl) acetate |
| SMILES | CCCCCC1COS(=O)(=O)N2C(C(C)C)C2(C#N)C1OC(C)=O |
| InChI | InChI=1S/C16H26N2O5S/c1-5-6-7-8-13-9-22-24(20,21)18-14(11(2)3)16(18,10-17)15(13)23-12(4)19/h11,13-15H,5-9H2,1-4H3 |
| InChIKey | OEBSQGKYUWQADR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|