C29H37NO2 — CID 123626374
10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile (PubChem CID 123626374) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is 10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile.
| Compound Name | 10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 123626374 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | 10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carbonitrile |
| SMILES | C=c1c(O)c(O)cc2c1=CC=C1C2(C)CCC2(C)C3CC(C)(C#N)CCC3(C)CCC12C |
| InChI | InChI=1S/C29H37NO2/c1-18-19-7-8-22-27(4,20(19)15-21(31)24(18)32)12-14-29(6)23-16-25(2,17-30)9-10-26(23,3)11-13-28(22,29)5/h7-8,15,23,31-32H,1,9-14,16H2,2-6H3 |
| InChIKey | RWUAJKSWBXQRQP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|