C36H44O4 — CID 90904145
benzyl (2R,4aS,6aR,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 90904145) has the molecular formula C36H44O4 and a molecular weight of 540.74 g/mol. Its IUPAC name is benzyl (2R,4aS,6aR,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | benzyl (2R,4aS,6aR,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 90904145 |
| Molecular Formula | C36H44O4 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | benzyl (2R,4aS,6aR,6aS,14aS,14bR)-10,11-dihydroxy-2,4a,6a,6a,14a-pentamethyl-9-methylidene-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | C=c1c(O)c(O)cc2c1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)OCc4ccccc4)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C36H44O4/c1-23-25-12-13-28-34(4,26(25)20-27(37)30(23)38)17-19-36(6)29-21-33(3,15-14-32(29,2)16-18-35(28,36)5)31(39)40-22-24-10-8-7-9-11-24/h7-13,20,29,37-38H,1,14-19,21-22H2,2-6H3/t29-,32-,33-,34+,35-,36+/m1/s1 |
| InChIKey | OFIVYTVEKITOHO-WFVGHVPHSA-N |
| XLogP | 6.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|