C38H59N — CID 143767435
(6aS,11R)-4,6a,6b,8a,11,14a-hexamethyl-2-methylidene-11-prop-1-en-2-yl-7,8,9,10,12,12a,13,14-octahydropicen-3-amine;but-1-ene;ethane (PubChem CID 143767435) has the molecular formula C38H59N and a molecular weight of 529.90 g/mol. Its IUPAC name is (6aS,11R)-4,6a,6b,8a,11,14a-hexamethyl-2-methylidene-11-prop-1-en-2-yl-7,8,9,10,12,12a,13,14-octahydropicen-3-amine;but-1-ene;ethane.
| Compound Name | (6aS,11R)-4,6a,6b,8a,11,14a-hexamethyl-2-methylidene-11-prop-1-en-2-yl-7,8,9,10,12,12a,13,14-octahydropicen-3-amine;but-1-ene;ethane |
|---|---|
| PubChem CID | 143767435 |
| Molecular Formula | C38H59N |
| Molecular Weight | 529.90 g/mol |
| Exact Mass | 529.46 |
| IUPAC Name | (6aS,11R)-4,6a,6b,8a,11,14a-hexamethyl-2-methylidene-11-prop-1-en-2-yl-7,8,9,10,12,12a,13,14-octahydropicen-3-amine;but-1-ene;ethane |
| SMILES | C=C(C)[C@]1(C)CCC2(C)CCC3(C)C4=CC=c5c(cc(=C)c(N)c5C)C4(C)CC[C@@]3(C)C2C1.C=CCC.CC |
| InChI | InChI=1S/C32H45N.C4H8.C2H6/c1-20(2)29(6)13-12-28(5)14-16-31(8)25-11-10-23-22(4)27(33)21(3)18-24(23)30(25,7)15-17-32(31,9)26(28)19-29;1-3-4-2;1-2/h10-11,18,26H,1,3,12-17,19,33H2,2,4-9H3;3H,1,4H2,2H3;1-2H3/t26?,28?,29-,30?,31?,32+;;/m1../s1 |
| InChIKey | DDQPUIMVUQEESN-BXBQQQFGSA-N |
| XLogP | 9.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.90 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|