C29H60 — CID 123674031
2,5,5,6,9,13,16,17,18-nonamethylicosane (PubChem CID 123674031) has the molecular formula C29H60 and a molecular weight of 408.80 g/mol. Its IUPAC name is 2,5,5,6,9,13,16,17,18-nonamethylicosane.
| Compound Name | 2,5,5,6,9,13,16,17,18-nonamethylicosane |
|---|---|
| PubChem CID | 123674031 |
| Molecular Formula | C29H60 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.47 |
| IUPAC Name | 2,5,5,6,9,13,16,17,18-nonamethylicosane |
| SMILES | CCC(C)C(C)C(C)CCC(C)CCCC(C)CCC(C)C(C)(C)CCC(C)C |
| InChI | InChI=1S/C29H60/c1-12-25(6)28(9)26(7)18-16-23(4)14-13-15-24(5)17-19-27(8)29(10,11)21-20-22(2)3/h22-28H,12-21H2,1-11H3 |
| InChIKey | RCAAZLRWZBQHKS-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |