C17H15IO3S — CID 123689124
5-iodo-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-1-benzofuran (PubChem CID 123689124) has the molecular formula C17H15IO3S and a molecular weight of 426.28 g/mol. Its IUPAC name is 5-iodo-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-1-benzofuran.
| Compound Name | 5-iodo-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-1-benzofuran |
|---|---|
| PubChem CID | 123689124 |
| Molecular Formula | C17H15IO3S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 5-iodo-2,7-dimethyl-3-(4-methylphenyl)sulfonyl-1-benzofuran |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)oc3c(C)cc(I)cc23)cc1 |
| InChI | InChI=1S/C17H15IO3S/c1-10-4-6-14(7-5-10)22(19,20)17-12(3)21-16-11(2)8-13(18)9-15(16)17/h4-9H,1-3H3 |
| InChIKey | GLFYNNXJQCTFIV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|