C21H17N3O — CID 123732597
[6-(3-isocyanophenyl)spiro[indene-3,4'-oxane]-1-yl]cyanamide (PubChem CID 123732597) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is [6-(3-isocyanophenyl)spiro[indene-3,4'-oxane]-1-yl]cyanamide.
| Compound Name | [6-(3-isocyanophenyl)spiro[indene-3,4'-oxane]-1-yl]cyanamide |
|---|---|
| PubChem CID | 123732597 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [6-(3-isocyanophenyl)spiro[indene-3,4'-oxane]-1-yl]cyanamide |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(NC#N)=CC32CCOCC2)c1 |
| InChI | InChI=1S/C21H17N3O/c1-23-17-4-2-3-15(11-17)16-5-6-19-18(12-16)20(24-14-22)13-21(19)7-9-25-10-8-21/h2-6,11-13,24H,7-10H2 |
| InChIKey | IGTJYKUEZNICBK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|